C31H36N2O8 — CID 139554670
[(E)-[1-[7-[(2E)-2-acetyloxyiminobutanoyl]-9,9-bis(2-methoxyethyl)fluoren-2-yl]-1-oxobutan-2-ylidene]amino] acetate (PubChem CID 139554670) has the molecular formula C31H36N2O8 and a molecular weight of 564.64 g/mol. Its IUPAC name is [(E)-[1-[7-[(2E)-2-acetyloxyiminobutanoyl]-9,9-bis(2-methoxyethyl)fluoren-2-yl]-1-oxobutan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[7-[(2E)-2-acetyloxyiminobutanoyl]-9,9-bis(2-methoxyethyl)fluoren-2-yl]-1-oxobutan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 139554670 |
| Molecular Formula | C31H36N2O8 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | [(E)-[1-[7-[(2E)-2-acetyloxyiminobutanoyl]-9,9-bis(2-methoxyethyl)fluoren-2-yl]-1-oxobutan-2-ylidene]amino] acetate |
| SMILES | CC/C(=N\OC(C)=O)C(=O)c1ccc2c(c1)C(CCOC)(CCOC)c1cc(C(=O)/C(CC)=N/OC(C)=O)ccc1-2 |
| InChI | InChI=1S/C31H36N2O8/c1-7-27(32-40-19(3)34)29(36)21-9-11-23-24-12-10-22(30(37)28(8-2)33-41-20(4)35)18-26(24)31(13-15-38-5,14-16-39-6)25(23)17-21/h9-12,17-18H,7-8,13-16H2,1-6H3/b32-27+,33-28+ |
| InChIKey | NGGYCPRBHNUJQA-MOEPYEHSSA-N |
| XLogP | 5.05 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|