C49H72N2O10 — CID 139554840
[(E)-[1-[7-[(2E)-2-acetyloxyiminohexanoyl]-9,9-bis[3-propoxy-2-(propoxymethyl)propyl]fluoren-2-yl]-1-oxohexan-2-ylidene]amino] acetate (PubChem CID 139554840) has the molecular formula C49H72N2O10 and a molecular weight of 849.12 g/mol. Its IUPAC name is [(E)-[1-[7-[(2E)-2-acetyloxyiminohexanoyl]-9,9-bis[3-propoxy-2-(propoxymethyl)propyl]fluoren-2-yl]-1-oxohexan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[7-[(2E)-2-acetyloxyiminohexanoyl]-9,9-bis[3-propoxy-2-(propoxymethyl)propyl]fluoren-2-yl]-1-oxohexan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 139554840 |
| Molecular Formula | C49H72N2O10 |
| Molecular Weight | 849.12 g/mol |
| Exact Mass | 848.52 |
| IUPAC Name | [(E)-[1-[7-[(2E)-2-acetyloxyiminohexanoyl]-9,9-bis[3-propoxy-2-(propoxymethyl)propyl]fluoren-2-yl]-1-oxohexan-2-ylidene]amino] acetate |
| SMILES | CCCC/C(=N\OC(C)=O)C(=O)c1ccc2c(c1)C(CC(COCCC)COCCC)(CC(COCCC)COCCC)c1cc(C(=O)/C(CCCC)=N/OC(C)=O)ccc1-2 |
| InChI | InChI=1S/C49H72N2O10/c1-9-15-17-45(50-60-35(7)52)47(54)39-19-21-41-42-22-20-40(48(55)46(18-16-10-2)51-61-36(8)53)28-44(42)49(43(41)27-39,29-37(31-56-23-11-3)32-57-24-12-4)30-38(33-58-25-13-5)34-59-26-14-6/h19-22,27-28,37-38H,9-18,23-26,29-34H2,1-8H3/b50-45+,51-46+ |
| InChIKey | YXOHFZZXDGRREQ-RVYIZOLHSA-N |
| XLogP | 10.26 |
| TPSA | 148.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.12 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|