C32H31ClF3NO3S — CID 172983040
[(E)-[5-(4-chlorophenyl)sulfanyl-1-oxo-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]pentan-2-ylidene]amino] acetate (PubChem CID 172983040) has the molecular formula C32H31ClF3NO3S and a molecular weight of 602.12 g/mol. Its IUPAC name is [(E)-[5-(4-chlorophenyl)sulfanyl-1-oxo-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]pentan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[5-(4-chlorophenyl)sulfanyl-1-oxo-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]pentan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 172983040 |
| Molecular Formula | C32H31ClF3NO3S |
| Molecular Weight | 602.12 g/mol |
| Exact Mass | 601.17 |
| IUPAC Name | [(E)-[5-(4-chlorophenyl)sulfanyl-1-oxo-1-[9-propyl-9-(3,3,3-trifluoropropyl)fluoren-2-yl]pentan-2-ylidene]amino] acetate |
| SMILES | CCCC1(CCC(F)(F)F)c2ccccc2-c2ccc(C(=O)/C(CCCSc3ccc(Cl)cc3)=N/OC(C)=O)cc21 |
| InChI | InChI=1S/C32H31ClF3NO3S/c1-3-16-31(17-18-32(34,35)36)27-8-5-4-7-25(27)26-15-10-22(20-28(26)31)30(39)29(37-40-21(2)38)9-6-19-41-24-13-11-23(33)12-14-24/h4-5,7-8,10-15,20H,3,6,9,16-19H2,1-2H3/b37-29+ |
| InChIKey | NUCZAWJQCRXHPU-SMTCOIIISA-N |
| XLogP | 9.42 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.12 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|