C31H27F6NO3 — CID 134459610
[(E)-[1-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]-3-(3-methylphenyl)-1-oxopropan-2-ylidene]amino] acetate (PubChem CID 134459610) has the molecular formula C31H27F6NO3 and a molecular weight of 575.55 g/mol. Its IUPAC name is [(E)-[1-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]-3-(3-methylphenyl)-1-oxopropan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]-3-(3-methylphenyl)-1-oxopropan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 134459610 |
| Molecular Formula | C31H27F6NO3 |
| Molecular Weight | 575.55 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | [(E)-[1-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]-3-(3-methylphenyl)-1-oxopropan-2-ylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\Cc1cccc(C)c1)C(=O)c1ccc2c(c1)C(CCC(F)(F)F)(CCC(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C31H27F6NO3/c1-19-6-5-7-21(16-19)17-27(38-41-20(2)39)28(40)22-10-11-24-23-8-3-4-9-25(23)29(26(24)18-22,12-14-30(32,33)34)13-15-31(35,36)37/h3-11,16,18H,12-15,17H2,1-2H3/b38-27+ |
| InChIKey | SVXHQYJJDRCSRN-ACPRRRJJSA-N |
| XLogP | 8.29 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.55 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|