C41H37NO4 — CID 122597198
[(E)-[1-(2-methylphenyl)-2-[7-(naphthalene-1-carbonyl)-9,9-dipropylfluoren-2-yl]-2-oxoethylidene]amino] acetate (PubChem CID 122597198) has the molecular formula C41H37NO4 and a molecular weight of 607.75 g/mol. Its IUPAC name is [(E)-[1-(2-methylphenyl)-2-[7-(naphthalene-1-carbonyl)-9,9-dipropylfluoren-2-yl]-2-oxoethylidene]amino] acetate.
| Compound Name | [(E)-[1-(2-methylphenyl)-2-[7-(naphthalene-1-carbonyl)-9,9-dipropylfluoren-2-yl]-2-oxoethylidene]amino] acetate |
|---|---|
| PubChem CID | 122597198 |
| Molecular Formula | C41H37NO4 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | [(E)-[1-(2-methylphenyl)-2-[7-(naphthalene-1-carbonyl)-9,9-dipropylfluoren-2-yl]-2-oxoethylidene]amino] acetate |
| SMILES | CCCC1(CCC)c2cc(C(=O)/C(=N/OC(C)=O)c3ccccc3C)ccc2-c2ccc(C(=O)c3cccc4ccccc34)cc21 |
| InChI | InChI=1S/C41H37NO4/c1-5-22-41(23-6-2)36-24-29(39(44)35-17-11-14-28-13-8-10-16-32(28)35)18-20-33(36)34-21-19-30(25-37(34)41)40(45)38(42-46-27(4)43)31-15-9-7-12-26(31)3/h7-21,24-25H,5-6,22-23H2,1-4H3/b42-38+ |
| InChIKey | BMWGUECCVVKTAS-WUHPQKATSA-N |
| XLogP | 9.40 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|