C40H35NO3 — CID 122597232
[(E)-[2-[9,9-bis(2-phenylethyl)fluoren-2-yl]-1-(2-methylphenyl)-2-oxoethylidene]amino] acetate (PubChem CID 122597232) has the molecular formula C40H35NO3 and a molecular weight of 577.72 g/mol. Its IUPAC name is [(E)-[2-[9,9-bis(2-phenylethyl)fluoren-2-yl]-1-(2-methylphenyl)-2-oxoethylidene]amino] acetate.
| Compound Name | [(E)-[2-[9,9-bis(2-phenylethyl)fluoren-2-yl]-1-(2-methylphenyl)-2-oxoethylidene]amino] acetate |
|---|---|
| PubChem CID | 122597232 |
| Molecular Formula | C40H35NO3 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | [(E)-[2-[9,9-bis(2-phenylethyl)fluoren-2-yl]-1-(2-methylphenyl)-2-oxoethylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(/C(=O)c1ccc2c(c1)C(CCc1ccccc1)(CCc1ccccc1)c1ccccc1-2)c1ccccc1C |
| InChI | InChI=1S/C40H35NO3/c1-28-13-9-10-18-33(28)38(41-44-29(2)42)39(43)32-21-22-35-34-19-11-12-20-36(34)40(37(35)27-32,25-23-30-14-5-3-6-15-30)26-24-31-16-7-4-8-17-31/h3-22,27H,23-26H2,1-2H3/b41-38+ |
| InChIKey | YNZBCNISMDYWKX-SACBSGMTSA-N |
| XLogP | 8.68 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|