C29H27Br2NO3 — CID 134453812
[(E)-[1-[9,9-bis(2-bromoethyl)fluoren-2-yl]-3-(3-methylphenyl)-1-oxopropan-2-ylidene]amino] acetate (PubChem CID 134453812) has the molecular formula C29H27Br2NO3 and a molecular weight of 597.35 g/mol. Its IUPAC name is [(E)-[1-[9,9-bis(2-bromoethyl)fluoren-2-yl]-3-(3-methylphenyl)-1-oxopropan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[9,9-bis(2-bromoethyl)fluoren-2-yl]-3-(3-methylphenyl)-1-oxopropan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 134453812 |
| Molecular Formula | C29H27Br2NO3 |
| Molecular Weight | 597.35 g/mol |
| Exact Mass | 595.04 |
| IUPAC Name | [(E)-[1-[9,9-bis(2-bromoethyl)fluoren-2-yl]-3-(3-methylphenyl)-1-oxopropan-2-ylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\Cc1cccc(C)c1)C(=O)c1ccc2c(c1)C(CCBr)(CCBr)c1ccccc1-2 |
| InChI | InChI=1S/C29H27Br2NO3/c1-19-6-5-7-21(16-19)17-27(32-35-20(2)33)28(34)22-10-11-24-23-8-3-4-9-25(23)29(12-14-30,13-15-31)26(24)18-22/h3-11,16,18H,12-15,17H2,1-2H3/b32-27+ |
| InChIKey | YFPZTMGOJHFZOA-QVAGMWBUSA-N |
| XLogP | 7.18 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.35 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|