C30H27F6NO3 — CID 154029738
[(Z)-[2-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]-1-(6-methylcyclohexa-1,3-dien-1-yl)-2-oxoethylidene]amino] acetate (PubChem CID 154029738) has the molecular formula C30H27F6NO3 and a molecular weight of 563.54 g/mol. Its IUPAC name is [(Z)-[2-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]-1-(6-methylcyclohexa-1,3-dien-1-yl)-2-oxoethylidene]amino] acetate.
| Compound Name | [(Z)-[2-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]-1-(6-methylcyclohexa-1,3-dien-1-yl)-2-oxoethylidene]amino] acetate |
|---|---|
| PubChem CID | 154029738 |
| Molecular Formula | C30H27F6NO3 |
| Molecular Weight | 563.54 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | [(Z)-[2-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]-1-(6-methylcyclohexa-1,3-dien-1-yl)-2-oxoethylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\C(=O)c1ccc2c(c1)C(CCC(F)(F)F)(CCC(F)(F)F)c1ccccc1-2)C1=CC=CCC1C |
| InChI | InChI=1S/C30H27F6NO3/c1-18-7-3-4-8-21(18)26(37-40-19(2)38)27(39)20-11-12-23-22-9-5-6-10-24(22)28(25(23)17-20,13-15-29(31,32)33)14-16-30(34,35)36/h3-6,8-12,17-18H,7,13-16H2,1-2H3/b37-26- |
| InChIKey | XSDRWGIXDAVMNF-UOZKZNBHSA-N |
| XLogP | 8.26 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.54 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|