C22H23NO3 — CID 122685051
[[1-(9,9-diethylfluoren-2-yl)-1-oxopropan-2-ylidene]amino] acetate (PubChem CID 122685051) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is [[1-(9,9-diethylfluoren-2-yl)-1-oxopropan-2-ylidene]amino] acetate.
| Compound Name | [[1-(9,9-diethylfluoren-2-yl)-1-oxopropan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 122685051 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | [[1-(9,9-diethylfluoren-2-yl)-1-oxopropan-2-ylidene]amino] acetate |
| SMILES | CCC1(CC)c2ccccc2-c2ccc(C(=O)C(C)=NOC(C)=O)cc21 |
| InChI | InChI=1S/C22H23NO3/c1-5-22(6-2)19-10-8-7-9-17(19)18-12-11-16(13-20(18)22)21(25)14(3)23-26-15(4)24/h7-13H,5-6H2,1-4H3 |
| InChIKey | XGPNZGRGJSYIHR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|