C22H22N2O2 — CID 140729147
[1-(9,9-diethyl-7-isocyanofluoren-2-yl)ethylideneamino] acetate (PubChem CID 140729147) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is [1-(9,9-diethyl-7-isocyanofluoren-2-yl)ethylideneamino] acetate.
| Compound Name | [1-(9,9-diethyl-7-isocyanofluoren-2-yl)ethylideneamino] acetate |
|---|---|
| PubChem CID | 140729147 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | [1-(9,9-diethyl-7-isocyanofluoren-2-yl)ethylideneamino] acetate |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(CC)(CC)c1cc(C(C)=NOC(C)=O)ccc1-2 |
| InChI | InChI=1S/C22H22N2O2/c1-6-22(7-2)20-12-16(14(3)24-26-15(4)25)8-10-18(20)19-11-9-17(23-5)13-21(19)22/h8-13H,6-7H2,1-4H3 |
| InChIKey | HPRMFCJRJGKUSQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 43.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|