C35H40N2O10S2 — CID 139554698
[(E)-[1-[7-[(2E)-2-acetyloxyiminohexanoyl]-9,9-bis(methylsulfanylcarbonyloxymethyl)fluoren-2-yl]-1-oxohexan-2-ylidene]amino] acetate (PubChem CID 139554698) has the molecular formula C35H40N2O10S2 and a molecular weight of 712.84 g/mol. Its IUPAC name is [(E)-[1-[7-[(2E)-2-acetyloxyiminohexanoyl]-9,9-bis(methylsulfanylcarbonyloxymethyl)fluoren-2-yl]-1-oxohexan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[7-[(2E)-2-acetyloxyiminohexanoyl]-9,9-bis(methylsulfanylcarbonyloxymethyl)fluoren-2-yl]-1-oxohexan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 139554698 |
| Molecular Formula | C35H40N2O10S2 |
| Molecular Weight | 712.84 g/mol |
| Exact Mass | 712.21 |
| IUPAC Name | [(E)-[1-[7-[(2E)-2-acetyloxyiminohexanoyl]-9,9-bis(methylsulfanylcarbonyloxymethyl)fluoren-2-yl]-1-oxohexan-2-ylidene]amino] acetate |
| SMILES | CCCC/C(=N\OC(C)=O)C(=O)c1ccc2c(c1)C(COC(=O)SC)(COC(=O)SC)c1cc(C(=O)/C(CCCC)=N/OC(C)=O)ccc1-2 |
| InChI | InChI=1S/C35H40N2O10S2/c1-7-9-11-29(36-46-21(3)38)31(40)23-13-15-25-26-16-14-24(32(41)30(12-10-8-2)37-47-22(4)39)18-28(26)35(27(25)17-23,19-44-33(42)48-5)20-45-34(43)49-6/h13-18H,7-12,19-20H2,1-6H3/b36-29+,37-30+ |
| InChIKey | FUNBVCWPRHPFHM-CWUFWRKASA-N |
| XLogP | 7.54 |
| TPSA | 164.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.84 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|