C33H35NO5 — CID 122597218
benzyl (4E)-4-acetyloxyimino-5-(9,9-dipropylfluoren-2-yl)-5-oxopentanoate (PubChem CID 122597218) has the molecular formula C33H35NO5 and a molecular weight of 525.65 g/mol. Its IUPAC name is benzyl (4E)-4-acetyloxyimino-5-(9,9-dipropylfluoren-2-yl)-5-oxopentanoate.
| Compound Name | benzyl (4E)-4-acetyloxyimino-5-(9,9-dipropylfluoren-2-yl)-5-oxopentanoate |
|---|---|
| PubChem CID | 122597218 |
| Molecular Formula | C33H35NO5 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | benzyl (4E)-4-acetyloxyimino-5-(9,9-dipropylfluoren-2-yl)-5-oxopentanoate |
| SMILES | CCCC1(CCC)c2ccccc2-c2ccc(C(=O)/C(CCC(=O)OCc3ccccc3)=N/OC(C)=O)cc21 |
| InChI | InChI=1S/C33H35NO5/c1-4-19-33(20-5-2)28-14-10-9-13-26(28)27-16-15-25(21-29(27)33)32(37)30(34-39-23(3)35)17-18-31(36)38-22-24-11-7-6-8-12-24/h6-16,21H,4-5,17-20,22H2,1-3H3/b34-30+ |
| InChIKey | VPVAHCVHIBRWFS-VBMGMRCRSA-N |
| XLogP | 7.18 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|