C41H37NO3 — CID 134453811
[(E)-[1-[9,9-bis(2-phenylethyl)fluoren-2-yl]-3-(3-methylphenyl)-1-oxopropan-2-ylidene]amino] acetate (PubChem CID 134453811) has the molecular formula C41H37NO3 and a molecular weight of 591.75 g/mol. Its IUPAC name is [(E)-[1-[9,9-bis(2-phenylethyl)fluoren-2-yl]-3-(3-methylphenyl)-1-oxopropan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[9,9-bis(2-phenylethyl)fluoren-2-yl]-3-(3-methylphenyl)-1-oxopropan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 134453811 |
| Molecular Formula | C41H37NO3 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | [(E)-[1-[9,9-bis(2-phenylethyl)fluoren-2-yl]-3-(3-methylphenyl)-1-oxopropan-2-ylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\Cc1cccc(C)c1)C(=O)c1ccc2c(c1)C(CCc1ccccc1)(CCc1ccccc1)c1ccccc1-2 |
| InChI | InChI=1S/C41H37NO3/c1-29-12-11-17-33(26-29)27-39(42-45-30(2)43)40(44)34-20-21-36-35-18-9-10-19-37(35)41(38(36)28-34,24-22-31-13-5-3-6-14-31)25-23-32-15-7-4-8-16-32/h3-21,26,28H,22-25,27H2,1-2H3/b42-39+ |
| InChIKey | UUTLXNPQUCRXQN-VJSBBTEDSA-N |
| XLogP | 8.87 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|