C27H33NO3 — CID 122695452
[(Z)-[1-(9,9-diethylfluoren-2-yl)-1-oxopentan-2-ylidene]amino] pentanoate (PubChem CID 122695452) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is [(Z)-[1-(9,9-diethylfluoren-2-yl)-1-oxopentan-2-ylidene]amino] pentanoate.
| Compound Name | [(Z)-[1-(9,9-diethylfluoren-2-yl)-1-oxopentan-2-ylidene]amino] pentanoate |
|---|---|
| PubChem CID | 122695452 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | [(Z)-[1-(9,9-diethylfluoren-2-yl)-1-oxopentan-2-ylidene]amino] pentanoate |
| SMILES | CCCCC(=O)O/N=C(/CCC)C(=O)c1ccc2c(c1)C(CC)(CC)c1ccccc1-2 |
| InChI | InChI=1S/C27H33NO3/c1-5-9-15-25(29)31-28-24(12-6-2)26(30)19-16-17-21-20-13-10-11-14-22(20)27(7-3,8-4)23(21)18-19/h10-11,13-14,16-18H,5-9,12,15H2,1-4H3/b28-24- |
| InChIKey | CXJKTVDSBGYVKF-COOPMVRXSA-N |
| XLogP | 6.85 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|