C31H33NO3 — CID 118371864
[(E)-1-[7-(2-methylbenzoyl)-9,9-dipropylfluoren-2-yl]ethylideneamino] acetate (PubChem CID 118371864) has the molecular formula C31H33NO3 and a molecular weight of 467.61 g/mol. Its IUPAC name is [(E)-1-[7-(2-methylbenzoyl)-9,9-dipropylfluoren-2-yl]ethylideneamino] acetate.
| Compound Name | [(E)-1-[7-(2-methylbenzoyl)-9,9-dipropylfluoren-2-yl]ethylideneamino] acetate |
|---|---|
| PubChem CID | 118371864 |
| Molecular Formula | C31H33NO3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | [(E)-1-[7-(2-methylbenzoyl)-9,9-dipropylfluoren-2-yl]ethylideneamino] acetate |
| SMILES | CCCC1(CCC)c2cc(C(=O)c3ccccc3C)ccc2-c2ccc(/C(C)=N/OC(C)=O)cc21 |
| InChI | InChI=1S/C31H33NO3/c1-6-16-31(17-7-2)28-18-23(21(4)32-35-22(5)33)12-14-26(28)27-15-13-24(19-29(27)31)30(34)25-11-9-8-10-20(25)3/h8-15,18-19H,6-7,16-17H2,1-5H3/b32-21+ |
| InChIKey | UYMSFKLRNAVZMM-RUMWWMSVSA-N |
| XLogP | 7.38 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|