C26H26N2O3 — CID 118601522
[(E)-1-[4-(ethylamino)-3-[3-(2-methylbenzoyl)phenyl]phenyl]ethylideneamino] acetate (PubChem CID 118601522) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is [(E)-1-[4-(ethylamino)-3-[3-(2-methylbenzoyl)phenyl]phenyl]ethylideneamino] acetate.
| Compound Name | [(E)-1-[4-(ethylamino)-3-[3-(2-methylbenzoyl)phenyl]phenyl]ethylideneamino] acetate |
|---|---|
| PubChem CID | 118601522 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | [(E)-1-[4-(ethylamino)-3-[3-(2-methylbenzoyl)phenyl]phenyl]ethylideneamino] acetate |
| SMILES | CCNc1ccc(/C(C)=N/OC(C)=O)cc1-c1cccc(C(=O)c2ccccc2C)c1 |
| InChI | InChI=1S/C26H26N2O3/c1-5-27-25-14-13-20(18(3)28-31-19(4)29)16-24(25)21-10-8-11-22(15-21)26(30)23-12-7-6-9-17(23)2/h6-16,27H,5H2,1-4H3/b28-18+ |
| InChIKey | AZLIJBPFZCSJSS-MTDXEUNCSA-N |
| XLogP | 5.61 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|