C44H39NO3 — CID 156516860
[(E)-[(2-methylphenyl)-[5-(naphthalene-1-carbonyl)-7,7-dipropylbenzo[g]fluoren-9-yl]methylidene]amino] acetate (PubChem CID 156516860) has the molecular formula C44H39NO3 and a molecular weight of 629.80 g/mol. Its IUPAC name is [(E)-[(2-methylphenyl)-[5-(naphthalene-1-carbonyl)-7,7-dipropylbenzo[g]fluoren-9-yl]methylidene]amino] acetate.
| Compound Name | [(E)-[(2-methylphenyl)-[5-(naphthalene-1-carbonyl)-7,7-dipropylbenzo[g]fluoren-9-yl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 156516860 |
| Molecular Formula | C44H39NO3 |
| Molecular Weight | 629.80 g/mol |
| Exact Mass | 629.29 |
| IUPAC Name | [(E)-[(2-methylphenyl)-[5-(naphthalene-1-carbonyl)-7,7-dipropylbenzo[g]fluoren-9-yl]methylidene]amino] acetate |
| SMILES | CCCC1(CCC)c2cc(/C(=N\OC(C)=O)c3ccccc3C)ccc2-c2c1cc(C(=O)c1cccc3ccccc13)c1ccccc21 |
| InChI | InChI=1S/C44H39NO3/c1-5-24-44(25-6-2)39-26-31(42(45-48-29(4)46)32-17-9-7-14-28(32)3)22-23-37(39)41-35-20-12-11-19-34(35)38(27-40(41)44)43(47)36-21-13-16-30-15-8-10-18-33(30)36/h7-23,26-27H,5-6,24-25H2,1-4H3/b45-42+ |
| InChIKey | DFDUJRYMKGCRJA-NYHNVNJYSA-N |
| XLogP | 10.71 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.80 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|