C31H29NO — CID 134225148
1-(9,9-dipropylfluoren-2-yl)-2-imino-2-naphthalen-1-ylethanone (PubChem CID 134225148) has the molecular formula C31H29NO and a molecular weight of 431.58 g/mol. Its IUPAC name is 1-(9,9-dipropylfluoren-2-yl)-2-imino-2-naphthalen-1-ylethanone.
| Compound Name | 1-(9,9-dipropylfluoren-2-yl)-2-imino-2-naphthalen-1-ylethanone |
|---|---|
| PubChem CID | 134225148 |
| Molecular Formula | C31H29NO |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 1-(9,9-dipropylfluoren-2-yl)-2-imino-2-naphthalen-1-ylethanone |
| SMILES | [H]/N=C(/C(=O)c1ccc2c(c1)C(CCC)(CCC)c1ccccc1-2)c1cccc2ccccc12 |
| InChI | InChI=1S/C31H29NO/c1-3-18-31(19-4-2)27-15-8-7-13-24(27)25-17-16-22(20-28(25)31)30(33)29(32)26-14-9-11-21-10-5-6-12-23(21)26/h5-17,20,32H,3-4,18-19H2,1-2H3/b32-29+ |
| InChIKey | DXXCLVMBDRPIFR-UUDCSCGESA-N |
| XLogP | 7.96 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|