C32H33NO7 — CID 144999512
acetic acid;methyl 3-[2-[2-imino-2-(2-methylphenyl)acetyl]-9-(3-methoxy-3-oxopropyl)fluoren-9-yl]propanoate (PubChem CID 144999512) has the molecular formula C32H33NO7 and a molecular weight of 543.62 g/mol. Its IUPAC name is acetic acid;methyl 3-[2-[2-imino-2-(2-methylphenyl)acetyl]-9-(3-methoxy-3-oxopropyl)fluoren-9-yl]propanoate.
| Compound Name | acetic acid;methyl 3-[2-[2-imino-2-(2-methylphenyl)acetyl]-9-(3-methoxy-3-oxopropyl)fluoren-9-yl]propanoate |
|---|---|
| PubChem CID | 144999512 |
| Molecular Formula | C32H33NO7 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | acetic acid;methyl 3-[2-[2-imino-2-(2-methylphenyl)acetyl]-9-(3-methoxy-3-oxopropyl)fluoren-9-yl]propanoate |
| SMILES | CC(=O)O.[H]/N=C(/C(=O)c1ccc2c(c1)C(CCC(=O)OC)(CCC(=O)OC)c1ccccc1-2)c1ccccc1C |
| InChI | InChI=1S/C30H29NO5.C2H4O2/c1-19-8-4-5-9-21(19)28(31)29(34)20-12-13-23-22-10-6-7-11-24(22)30(25(23)18-20,16-14-26(32)35-2)17-15-27(33)36-3;1-2(3)4/h4-13,18,31H,14-17H2,1-3H3;1H3,(H,3,4)/b31-28+; |
| InChIKey | CIJWOLINWRETMN-KAHIUYCRSA-N |
| XLogP | 5.51 |
| TPSA | 130.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|