C36H41NO2 — CID 167065613
3-cyclohexyl-2-imino-1-[7-(2-methylbenzoyl)-9,9-dipropylfluoren-2-yl]propan-1-one (PubChem CID 167065613) has the molecular formula C36H41NO2 and a molecular weight of 519.73 g/mol. Its IUPAC name is 3-cyclohexyl-2-imino-1-[7-(2-methylbenzoyl)-9,9-dipropylfluoren-2-yl]propan-1-one.
| Compound Name | 3-cyclohexyl-2-imino-1-[7-(2-methylbenzoyl)-9,9-dipropylfluoren-2-yl]propan-1-one |
|---|---|
| PubChem CID | 167065613 |
| Molecular Formula | C36H41NO2 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | 3-cyclohexyl-2-imino-1-[7-(2-methylbenzoyl)-9,9-dipropylfluoren-2-yl]propan-1-one |
| SMILES | [H]/N=C(\CC1CCCCC1)C(=O)c1ccc2c(c1)C(CCC)(CCC)c1cc(C(=O)c3ccccc3C)ccc1-2 |
| InChI | InChI=1S/C36H41NO2/c1-4-19-36(20-5-2)31-22-26(34(38)28-14-10-9-11-24(28)3)15-17-29(31)30-18-16-27(23-32(30)36)35(39)33(37)21-25-12-7-6-8-13-25/h9-11,14-18,22-23,25,37H,4-8,12-13,19-21H2,1-3H3/b37-33+ |
| InChIKey | FMDSTUTWDGYVGJ-LAWMERGMSA-N |
| XLogP | 9.27 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|