C25H20F3NO — CID 123486508
2-[(4-ethanimidoylphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]-2,3-dihydroinden-1-one (PubChem CID 123486508) has the molecular formula C25H20F3NO and a molecular weight of 407.44 g/mol. Its IUPAC name is 2-[(4-ethanimidoylphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]-2,3-dihydroinden-1-one.
| Compound Name | 2-[(4-ethanimidoylphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 123486508 |
| Molecular Formula | C25H20F3NO |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-[(4-ethanimidoylphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]-2,3-dihydroinden-1-one |
| SMILES | [H]/N=C(\C)c1ccc(CC2Cc3c(cccc3-c3cccc(C(F)(F)F)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H20F3NO/c1-15(29)17-10-8-16(9-11-17)12-19-14-23-21(6-3-7-22(23)24(19)30)18-4-2-5-20(13-18)25(26,27)28/h2-11,13,19,29H,12,14H2,1H3/b29-15+ |
| InChIKey | VKVQEQBJLGIMPK-WKULSOCRSA-N |
| XLogP | 6.36 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|