C33H32N2O4 — CID 162451765
[(E)-[(2-methylphenyl)-(5-nitro-7,7-dipropylbenzo[g]fluoren-9-yl)methylidene]amino] acetate (PubChem CID 162451765) has the molecular formula C33H32N2O4 and a molecular weight of 520.63 g/mol. Its IUPAC name is [(E)-[(2-methylphenyl)-(5-nitro-7,7-dipropylbenzo[g]fluoren-9-yl)methylidene]amino] acetate.
| Compound Name | [(E)-[(2-methylphenyl)-(5-nitro-7,7-dipropylbenzo[g]fluoren-9-yl)methylidene]amino] acetate |
|---|---|
| PubChem CID | 162451765 |
| Molecular Formula | C33H32N2O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | [(E)-[(2-methylphenyl)-(5-nitro-7,7-dipropylbenzo[g]fluoren-9-yl)methylidene]amino] acetate |
| SMILES | CCCC1(CCC)c2cc(/C(=N\OC(C)=O)c3ccccc3C)ccc2-c2c1cc([N+](=O)[O-])c1ccccc21 |
| InChI | InChI=1S/C33H32N2O4/c1-5-17-33(18-6-2)28-19-23(32(34-39-22(4)36)24-12-8-7-11-21(24)3)15-16-27(28)31-26-14-10-9-13-25(26)30(35(37)38)20-29(31)33/h7-16,19-20H,5-6,17-18H2,1-4H3/b34-32+ |
| InChIKey | HZKMOSUKICMRNJ-NWBJSICCSA-N |
| XLogP | 8.24 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|