C31H26N2O4 — CID 144596766
[(Z)-[(9,9-dimethyl-7-nitrofluoren-2-yl)-(2-methylphenyl)methylidene]amino] 2-phenylacetate (PubChem CID 144596766) has the molecular formula C31H26N2O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is [(Z)-[(9,9-dimethyl-7-nitrofluoren-2-yl)-(2-methylphenyl)methylidene]amino] 2-phenylacetate.
| Compound Name | [(Z)-[(9,9-dimethyl-7-nitrofluoren-2-yl)-(2-methylphenyl)methylidene]amino] 2-phenylacetate |
|---|---|
| PubChem CID | 144596766 |
| Molecular Formula | C31H26N2O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | [(Z)-[(9,9-dimethyl-7-nitrofluoren-2-yl)-(2-methylphenyl)methylidene]amino] 2-phenylacetate |
| SMILES | Cc1ccccc1/C(=N\OC(=O)Cc1ccccc1)c1ccc2c(c1)C(C)(C)c1cc([N+](=O)[O-])ccc1-2 |
| InChI | InChI=1S/C31H26N2O4/c1-20-9-7-8-12-24(20)30(32-37-29(34)17-21-10-5-4-6-11-21)22-13-15-25-26-16-14-23(33(35)36)19-28(26)31(2,3)27(25)18-22/h4-16,18-19H,17H2,1-3H3/b32-30- |
| InChIKey | RRSPAOAQGPSPGG-GCUVURNUSA-N |
| XLogP | 6.75 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|