C32H40N2O4 — CID 145288716
[(Z)-[(9,9-dimethyl-7-nitrofluoren-2-yl)-(4-ethylcyclohexyl)methylidene]amino] 3-cyclopentylpropanoate (PubChem CID 145288716) has the molecular formula C32H40N2O4 and a molecular weight of 516.68 g/mol. Its IUPAC name is [(Z)-[(9,9-dimethyl-7-nitrofluoren-2-yl)-(4-ethylcyclohexyl)methylidene]amino] 3-cyclopentylpropanoate.
| Compound Name | [(Z)-[(9,9-dimethyl-7-nitrofluoren-2-yl)-(4-ethylcyclohexyl)methylidene]amino] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 145288716 |
| Molecular Formula | C32H40N2O4 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | [(Z)-[(9,9-dimethyl-7-nitrofluoren-2-yl)-(4-ethylcyclohexyl)methylidene]amino] 3-cyclopentylpropanoate |
| SMILES | CCC1CCC(/C(=N/OC(=O)CCC2CCCC2)c2ccc3c(c2)C(C)(C)c2cc([N+](=O)[O-])ccc2-3)CC1 |
| InChI | InChI=1S/C32H40N2O4/c1-4-21-9-12-23(13-10-21)31(33-38-30(35)18-11-22-7-5-6-8-22)24-14-16-26-27-17-15-25(34(36)37)20-29(27)32(2,3)28(26)19-24/h14-17,19-23H,4-13,18H2,1-3H3/b33-31- |
| InChIKey | RAZKBLCGXLWPAL-FPODKLOTSA-N |
| XLogP | 8.34 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|