C22H24ClNO3 — CID 145412519
3-chloro-1-(7-nitro-9,9-dipropylfluoren-2-yl)propan-1-one (PubChem CID 145412519) has the molecular formula C22H24ClNO3 and a molecular weight of 385.89 g/mol. Its IUPAC name is 3-chloro-1-(7-nitro-9,9-dipropylfluoren-2-yl)propan-1-one.
| Compound Name | 3-chloro-1-(7-nitro-9,9-dipropylfluoren-2-yl)propan-1-one |
|---|---|
| PubChem CID | 145412519 |
| Molecular Formula | C22H24ClNO3 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-chloro-1-(7-nitro-9,9-dipropylfluoren-2-yl)propan-1-one |
| SMILES | CCCC1(CCC)c2cc(C(=O)CCCl)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C22H24ClNO3/c1-3-10-22(11-4-2)19-13-15(21(25)9-12-23)5-7-17(19)18-8-6-16(24(26)27)14-20(18)22/h5-8,13-14H,3-4,9-12H2,1-2H3 |
| InChIKey | NSTHBBUGQVVDMH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|