C31H33ClN2O4S — CID 123664259
[[4-(4-chlorophenyl)sulfanyl-1-(7-nitro-9,9-dipropylfluoren-2-yl)butylidene]amino] acetate (PubChem CID 123664259) has the molecular formula C31H33ClN2O4S and a molecular weight of 565.14 g/mol. Its IUPAC name is [[4-(4-chlorophenyl)sulfanyl-1-(7-nitro-9,9-dipropylfluoren-2-yl)butylidene]amino] acetate.
| Compound Name | [[4-(4-chlorophenyl)sulfanyl-1-(7-nitro-9,9-dipropylfluoren-2-yl)butylidene]amino] acetate |
|---|---|
| PubChem CID | 123664259 |
| Molecular Formula | C31H33ClN2O4S |
| Molecular Weight | 565.14 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | [[4-(4-chlorophenyl)sulfanyl-1-(7-nitro-9,9-dipropylfluoren-2-yl)butylidene]amino] acetate |
| SMILES | CCCC1(CCC)c2cc(C(CCCSc3ccc(Cl)cc3)=NOC(C)=O)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C31H33ClN2O4S/c1-4-16-31(17-5-2)28-19-22(8-14-26(28)27-15-11-24(34(36)37)20-29(27)31)30(33-38-21(3)35)7-6-18-39-25-12-9-23(32)10-13-25/h8-15,19-20H,4-7,16-18H2,1-3H3 |
| InChIKey | WMFPYPYHXAMJMM-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.14 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|