C31H34N2O4 — CID 162451777
[(E)-[(9,9-dibutyl-7-nitrofluoren-2-yl)-(2-methylphenyl)methylidene]amino] acetate (PubChem CID 162451777) has the molecular formula C31H34N2O4 and a molecular weight of 498.62 g/mol. Its IUPAC name is [(E)-[(9,9-dibutyl-7-nitrofluoren-2-yl)-(2-methylphenyl)methylidene]amino] acetate.
| Compound Name | [(E)-[(9,9-dibutyl-7-nitrofluoren-2-yl)-(2-methylphenyl)methylidene]amino] acetate |
|---|---|
| PubChem CID | 162451777 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | [(E)-[(9,9-dibutyl-7-nitrofluoren-2-yl)-(2-methylphenyl)methylidene]amino] acetate |
| SMILES | CCCCC1(CCCC)c2cc(/C(=N\OC(C)=O)c3ccccc3C)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C31H34N2O4/c1-5-7-17-31(18-8-6-2)28-19-23(30(32-37-22(4)34)25-12-10-9-11-21(25)3)13-15-26(28)27-16-14-24(33(35)36)20-29(27)31/h9-16,19-20H,5-8,17-18H2,1-4H3/b32-30+ |
| InChIKey | OKVVXPQXMLGFEL-NHQGMKOOSA-N |
| XLogP | 7.87 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|