C29H30ClNO3S — CID 118371888
4-(4-chlorophenyl)sulfanyl-1-(7-nitro-9,9-dipropylfluoren-2-yl)butan-1-one (PubChem CID 118371888) has the molecular formula C29H30ClNO3S and a molecular weight of 508.08 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-1-(7-nitro-9,9-dipropylfluoren-2-yl)butan-1-one.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-1-(7-nitro-9,9-dipropylfluoren-2-yl)butan-1-one |
|---|---|
| PubChem CID | 118371888 |
| Molecular Formula | C29H30ClNO3S |
| Molecular Weight | 508.08 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-1-(7-nitro-9,9-dipropylfluoren-2-yl)butan-1-one |
| SMILES | CCCC1(CCC)c2cc(C(=O)CCCSc3ccc(Cl)cc3)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C29H30ClNO3S/c1-3-15-29(16-4-2)26-18-20(28(32)6-5-17-35-23-11-8-21(30)9-12-23)7-13-24(26)25-14-10-22(31(33)34)19-27(25)29/h7-14,18-19H,3-6,15-17H2,1-2H3 |
| InChIKey | DMICEAHFHTTWSC-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.08 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|