C10H10ClO2S- — CID 2307143
4-(4-chlorophenyl)sulfanylbutanoate (PubChem CID 2307143) has the molecular formula C10H10ClO2S- and a molecular weight of 229.71 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanylbutanoate.
| Compound Name | 4-(4-chlorophenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 2307143 |
| Molecular Formula | C10H10ClO2S- |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanylbutanoate |
| SMILES | O=C([O-])CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H11ClO2S/c11-8-3-5-9(6-4-8)14-7-1-2-10(12)13/h3-6H,1-2,7H2,(H,12,13)/p-1 |
| InChIKey | SBRQBQHVYFSULX-UHFFFAOYSA-M |
| XLogP | 1.96 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|