C14H20ClNO4S — CID 107846245
4-(4-chlorophenyl)sulfanyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]butanamide (PubChem CID 107846245) has the molecular formula C14H20ClNO4S and a molecular weight of 333.84 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 107846245 |
| Molecular Formula | C14H20ClNO4S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]butanamide |
| SMILES | O=C(CCCSc1ccc(Cl)cc1)NC(CO)(CO)CO |
| InChI | InChI=1S/C14H20ClNO4S/c15-11-3-5-12(6-4-11)21-7-1-2-13(20)16-14(8-17,9-18)10-19/h3-6,17-19H,1-2,7-10H2,(H,16,20) |
| InChIKey | ARNAJLHKWNYBIO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|