C15H24Cl2N2OS — CID 119570011
N-[3-(aminomethyl)pentan-3-yl]-3-(4-chlorophenyl)sulfanylpropanamide;hydrochloride (PubChem CID 119570011) has the molecular formula C15H24Cl2N2OS and a molecular weight of 351.34 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-3-(4-chlorophenyl)sulfanylpropanamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-3-(4-chlorophenyl)sulfanylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119570011 |
| Molecular Formula | C15H24Cl2N2OS |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-3-(4-chlorophenyl)sulfanylpropanamide;hydrochloride |
| SMILES | CCC(CC)(CN)NC(=O)CCSc1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C15H23ClN2OS.ClH/c1-3-15(4-2,11-17)18-14(19)9-10-20-13-7-5-12(16)6-8-13;/h5-8H,3-4,9-11,17H2,1-2H3,(H,18,19);1H |
| InChIKey | PWWAUERYJOSMNO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |