C23H27NO3 — CID 141396577
2-(9,9-dibutyl-7-nitrofluoren-2-yl)acetaldehyde (PubChem CID 141396577) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 2-(9,9-dibutyl-7-nitrofluoren-2-yl)acetaldehyde.
| Compound Name | 2-(9,9-dibutyl-7-nitrofluoren-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 141396577 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-(9,9-dibutyl-7-nitrofluoren-2-yl)acetaldehyde |
| SMILES | CCCCC1(CCCC)c2cc(CC=O)ccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C23H27NO3/c1-3-5-12-23(13-6-4-2)21-15-17(11-14-25)7-9-19(21)20-10-8-18(24(26)27)16-22(20)23/h7-10,14-16H,3-6,11-13H2,1-2H3 |
| InChIKey | ZLIMHRKPTGFIQP-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|