C27H38 — CID 153392949
9,9-dibutyl-2,7-di(propan-2-yl)fluorene (PubChem CID 153392949) has the molecular formula C27H38 and a molecular weight of 362.60 g/mol. Its IUPAC name is 9,9-dibutyl-2,7-di(propan-2-yl)fluorene.
| Compound Name | 9,9-dibutyl-2,7-di(propan-2-yl)fluorene |
|---|---|
| PubChem CID | 153392949 |
| Molecular Formula | C27H38 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | 9,9-dibutyl-2,7-di(propan-2-yl)fluorene |
| SMILES | CCCCC1(CCCC)c2cc(C(C)C)ccc2-c2ccc(C(C)C)cc21 |
| InChI | InChI=1S/C27H38/c1-7-9-15-27(16-10-8-2)25-17-21(19(3)4)11-13-23(25)24-14-12-22(20(5)6)18-26(24)27/h11-14,17-20H,7-10,15-16H2,1-6H3 |
| InChIKey | VEGILVKKLFUJSI-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |