C35H58B2-2 — CID 101466054
(9,9-dioctyl-7-trimethylboranuidylfluoren-2-yl)-trimethylboranuide (PubChem CID 101466054) has the molecular formula C35H58B2-2 and a molecular weight of 500.47 g/mol. Its IUPAC name is (9,9-dioctyl-7-trimethylboranuidylfluoren-2-yl)-trimethylboranuide.
| Compound Name | (9,9-dioctyl-7-trimethylboranuidylfluoren-2-yl)-trimethylboranuide |
|---|---|
| PubChem CID | 101466054 |
| Molecular Formula | C35H58B2-2 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.47 |
| IUPAC Name | (9,9-dioctyl-7-trimethylboranuidylfluoren-2-yl)-trimethylboranuide |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc([B-](C)(C)C)ccc2-c2ccc([B-](C)(C)C)cc21 |
| InChI | InChI=1S/C35H58B2/c1-9-11-13-15-17-19-25-35(26-20-18-16-14-12-10-2)33-27-29(36(3,4)5)21-23-31(33)32-24-22-30(28-34(32)35)37(6,7)8/h21-24,27-28H,9-20,25-26H2,1-8H3/q-2 |
| InChIKey | JVHNRBCISYTKQH-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|