C29H44Cl2Si2 — CID 132918715
chloro-[7-[chloro(dimethyl)silyl]-9,9-dihexylfluoren-2-yl]-dimethylsilane (PubChem CID 132918715) has the molecular formula C29H44Cl2Si2 and a molecular weight of 519.75 g/mol. Its IUPAC name is chloro-[7-[chloro(dimethyl)silyl]-9,9-dihexylfluoren-2-yl]-dimethylsilane.
| Compound Name | chloro-[7-[chloro(dimethyl)silyl]-9,9-dihexylfluoren-2-yl]-dimethylsilane |
|---|---|
| PubChem CID | 132918715 |
| Molecular Formula | C29H44Cl2Si2 |
| Molecular Weight | 519.75 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | chloro-[7-[chloro(dimethyl)silyl]-9,9-dihexylfluoren-2-yl]-dimethylsilane |
| SMILES | CCCCCCC1(CCCCCC)c2cc([Si](C)(C)Cl)ccc2-c2ccc([Si](C)(C)Cl)cc21 |
| InChI | InChI=1S/C29H44Cl2Si2/c1-7-9-11-13-19-29(20-14-12-10-8-2)27-21-23(32(3,4)30)15-17-25(27)26-18-16-24(22-28(26)29)33(5,6)31/h15-18,21-22H,7-14,19-20H2,1-6H3 |
| InChIKey | YRHHDXLGONMXDK-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.75 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|