C35H32Cl12N6 — CID 142638991
2-[7-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-9,9-dihexylfluoren-2-yl]-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 142638991) has the molecular formula C35H32Cl12N6 and a molecular weight of 962.12 g/mol. Its IUPAC name is 2-[7-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-9,9-dihexylfluoren-2-yl]-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-[7-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-9,9-dihexylfluoren-2-yl]-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 142638991 |
| Molecular Formula | C35H32Cl12N6 |
| Molecular Weight | 962.12 g/mol |
| Exact Mass | 955.90 |
| IUPAC Name | 2-[7-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-9,9-dihexylfluoren-2-yl]-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | CCCCCCC1(CCCCCC)c2cc(-c3nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n3)ccc2-c2ccc(-c3nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n3)cc21 |
| InChI | InChI=1S/C35H32Cl12N6/c1-3-5-7-9-15-31(16-10-8-6-4-2)23-17-19(25-48-27(32(36,37)38)52-28(49-25)33(39,40)41)11-13-21(23)22-14-12-20(18-24(22)31)26-50-29(34(42,43)44)53-30(51-26)35(45,46)47/h11-14,17-18H,3-10,15-16H2,1-2H3 |
| InChIKey | XQANPSLDMIMGDS-UHFFFAOYSA-N |
| XLogP | 14.90 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.12 |
| LogP ≤ 5 | 14.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|