C25H30 — CID 178181307
2,7-di(propan-2-yl)-9,9-bis(prop-2-enyl)fluorene (PubChem CID 178181307) has the molecular formula C25H30 and a molecular weight of 330.52 g/mol. Its IUPAC name is 2,7-di(propan-2-yl)-9,9-bis(prop-2-enyl)fluorene.
| Compound Name | 2,7-di(propan-2-yl)-9,9-bis(prop-2-enyl)fluorene |
|---|---|
| PubChem CID | 178181307 |
| Molecular Formula | C25H30 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 2,7-di(propan-2-yl)-9,9-bis(prop-2-enyl)fluorene |
| SMILES | C=CCC1(CC=C)c2cc(C(C)C)ccc2-c2ccc(C(C)C)cc21 |
| InChI | InChI=1S/C25H30/c1-7-13-25(14-8-2)23-15-19(17(3)4)9-11-21(23)22-12-10-20(18(5)6)16-24(22)25/h7-12,15-18H,1-2,13-14H2,3-6H3 |
| InChIKey | GJGQSJCOOIEUIE-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|