C23H26 — CID 178181319
2',7'-di(propan-2-yl)spiro[cyclopentene-4,9'-fluorene] (PubChem CID 178181319) has the molecular formula C23H26 and a molecular weight of 302.46 g/mol. Its IUPAC name is 2',7'-di(propan-2-yl)spiro[cyclopentene-4,9'-fluorene].
| Compound Name | 2',7'-di(propan-2-yl)spiro[cyclopentene-4,9'-fluorene] |
|---|---|
| PubChem CID | 178181319 |
| Molecular Formula | C23H26 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 2',7'-di(propan-2-yl)spiro[cyclopentene-4,9'-fluorene] |
| SMILES | CC(C)c1ccc2c(c1)C1(CC=CC1)c1cc(C(C)C)ccc1-2 |
| InChI | InChI=1S/C23H26/c1-15(2)17-7-9-19-20-10-8-18(16(3)4)14-22(20)23(21(19)13-17)11-5-6-12-23/h5-10,13-16H,11-12H2,1-4H3 |
| InChIKey | PVIPNLCLGGVRBZ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|