C15H20 — CID 157108603
3,3-dimethyl-2-methylidene-5-propan-2-yl-1H-indene (PubChem CID 157108603) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 3,3-dimethyl-2-methylidene-5-propan-2-yl-1H-indene.
| Compound Name | 3,3-dimethyl-2-methylidene-5-propan-2-yl-1H-indene |
|---|---|
| PubChem CID | 157108603 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 3,3-dimethyl-2-methylidene-5-propan-2-yl-1H-indene |
| SMILES | C=C1Cc2ccc(C(C)C)cc2C1(C)C |
| InChI | InChI=1S/C15H20/c1-10(2)12-6-7-13-8-11(3)15(4,5)14(13)9-12/h6-7,9-10H,3,8H2,1-2,4-5H3 |
| InChIKey | BNNGLNCJGLKGQE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|