C21H26O — CID 130401999
(9S)-2-tert-butyl-9-methyl-7-propan-2-ylfluoren-9-ol (PubChem CID 130401999) has the molecular formula C21H26O and a molecular weight of 294.44 g/mol. Its IUPAC name is (9S)-2-tert-butyl-9-methyl-7-propan-2-ylfluoren-9-ol.
| Compound Name | (9S)-2-tert-butyl-9-methyl-7-propan-2-ylfluoren-9-ol |
|---|---|
| PubChem CID | 130401999 |
| Molecular Formula | C21H26O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (9S)-2-tert-butyl-9-methyl-7-propan-2-ylfluoren-9-ol |
| SMILES | CC(C)c1ccc2c(c1)[C@](C)(O)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C21H26O/c1-13(2)14-7-9-16-17-10-8-15(20(3,4)5)12-19(17)21(6,22)18(16)11-14/h7-13,22H,1-6H3/t21-/m0/s1 |
| InChIKey | MZZZMXOQGFBFLV-NRFANRHFSA-N |
| XLogP | 5.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |