C25H36Si — CID 67896056
(2,7-ditert-butyl-9-methylfluoren-9-yl)-trimethylsilane (PubChem CID 67896056) has the molecular formula C25H36Si and a molecular weight of 364.65 g/mol. Its IUPAC name is (2,7-ditert-butyl-9-methylfluoren-9-yl)-trimethylsilane.
| Compound Name | (2,7-ditert-butyl-9-methylfluoren-9-yl)-trimethylsilane |
|---|---|
| PubChem CID | 67896056 |
| Molecular Formula | C25H36Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (2,7-ditert-butyl-9-methylfluoren-9-yl)-trimethylsilane |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C)([Si](C)(C)C)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C25H36Si/c1-23(2,3)17-11-13-19-20-14-12-18(24(4,5)6)16-22(20)25(7,21(19)15-17)26(8,9)10/h11-16H,1-10H3 |
| InChIKey | KBJFZBZQZKACOL-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|