About 2-tert-butyl-9,9-difluoro-7-methylfluorene;ethane
2-tert-butyl-9,9-difluoro-7-methylfluorene;ethane (PubChem CID 157036733) has the molecular formula C22H30F2
and a molecular weight of 332.48 g/mol. Its IUPAC name is 2-tert-butyl-9,9-difluoro-7-methylfluorene;ethane.
Molecular Properties
| Compound Name | 2-tert-butyl-9,9-difluoro-7-methylfluorene;ethane |
| PubChem CID | 157036733 |
| Molecular Formula | C22H30F2 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 2-tert-butyl-9,9-difluoro-7-methylfluorene;ethane |
| SMILES | CC.CC.Cc1ccc2c(c1)C(F)(F)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C18H18F2.2C2H6/c1-11-5-7-13-14-8-6-12(17(2,3)4)10-16(14)18(19,20)15(13)9-11;2*1-2/h5-10H,1-4H3;2*1-2H3 |
| InChIKey | OVRRBKXDJAUDGM-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-tert-butyl-9,9-difluoro-7-methylfluorene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-9,9-difluoro-7-methylfluorene;ethane?
The IUPAC name of 2-tert-butyl-9,9-difluoro-7-methylfluorene;ethane (CID 157036733) is 2-tert-butyl-9,9-difluoro-7-methylfluorene;ethane.
What is the SMILES notation for 2-tert-butyl-9,9-difluoro-7-methylfluorene;ethane?
The canonical SMILES for 2-tert-butyl-9,9-difluoro-7-methylfluorene;ethane is CC.CC.Cc1ccc2c(c1)C(F)(F)c1cc(C(C)(C)C)ccc1-2.
What is the InChIKey of 2-tert-butyl-9,9-difluoro-7-methylfluorene;ethane?
The InChIKey is OVRRBKXDJAUDGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F2.2C2H6/c1-11-5-7-13-14-8-6-12(17(2,3)4)10-16(14)18(19,20)15(13)9-11;2*1-2/h5-10H,1-4H3;2*1-2H3.
What are the key properties of 2-tert-butyl-9,9-difluoro-7-methylfluorene;ethane?
2-tert-butyl-9,9-difluoro-7-methylfluorene;ethane has a molecular weight of 332.48 g/mol, XLogP of 7.47, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-9,9-difluoro-7-methylfluorene;ethane is sourced from PubChem (CID 157036733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).