C32H50 — CID 143365607
butane;2-tert-butyl-7-methyl-9,9-bis(2-methylbutyl)fluorene (PubChem CID 143365607) has the molecular formula C32H50 and a molecular weight of 434.75 g/mol. Its IUPAC name is butane;2-tert-butyl-7-methyl-9,9-bis(2-methylbutyl)fluorene.
| Compound Name | butane;2-tert-butyl-7-methyl-9,9-bis(2-methylbutyl)fluorene |
|---|---|
| PubChem CID | 143365607 |
| Molecular Formula | C32H50 |
| Molecular Weight | 434.75 g/mol |
| Exact Mass | 434.39 |
| IUPAC Name | butane;2-tert-butyl-7-methyl-9,9-bis(2-methylbutyl)fluorene |
| SMILES | CCC(C)CC1(CC(C)CC)c2cc(C)ccc2-c2ccc(C(C)(C)C)cc21.CCCC |
| InChI | InChI=1S/C28H40.C4H10/c1-9-19(3)17-28(18-20(4)10-2)25-15-21(5)11-13-23(25)24-14-12-22(16-26(24)28)27(6,7)8;1-3-4-2/h11-16,19-20H,9-10,17-18H2,1-8H3;3-4H2,1-2H3 |
| InChIKey | KJMJRUBGBOOVED-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.75 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |