C43H52 — CID 59512850
9-ethyl-2-[9-ethyl-9-(3-methylpentyl)fluoren-2-yl]-7-methyl-9-(3-methylpentyl)fluorene (PubChem CID 59512850) has the molecular formula C43H52 and a molecular weight of 568.89 g/mol. Its IUPAC name is 9-ethyl-2-[9-ethyl-9-(3-methylpentyl)fluoren-2-yl]-7-methyl-9-(3-methylpentyl)fluorene.
| Compound Name | 9-ethyl-2-[9-ethyl-9-(3-methylpentyl)fluoren-2-yl]-7-methyl-9-(3-methylpentyl)fluorene |
|---|---|
| PubChem CID | 59512850 |
| Molecular Formula | C43H52 |
| Molecular Weight | 568.89 g/mol |
| Exact Mass | 568.41 |
| IUPAC Name | 9-ethyl-2-[9-ethyl-9-(3-methylpentyl)fluoren-2-yl]-7-methyl-9-(3-methylpentyl)fluorene |
| SMILES | CCC(C)CCC1(CC)c2ccccc2-c2ccc(-c3ccc4c(c3)C(CC)(CCC(C)CC)c3cc(C)ccc3-4)cc21 |
| InChI | InChI=1S/C43H52/c1-8-29(5)22-24-42(10-3)38-15-13-12-14-34(38)36-20-17-32(27-40(36)42)33-18-21-37-35-19-16-31(7)26-39(35)43(11-4,41(37)28-33)25-23-30(6)9-2/h12-21,26-30H,8-11,22-25H2,1-7H3 |
| InChIKey | STTXLJMEDKVKSZ-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.89 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |