C63H73Br — CID 59801302
2-[9,9-bis(3-methylbutyl)fluoren-2-yl]-7-[7-bromo-9,9-bis(3-methylbutyl)fluoren-2-yl]-9,9-diethylfluorene (PubChem CID 59801302) has the molecular formula C63H73Br and a molecular weight of 910.18 g/mol. Its IUPAC name is 2-[9,9-bis(3-methylbutyl)fluoren-2-yl]-7-[7-bromo-9,9-bis(3-methylbutyl)fluoren-2-yl]-9,9-diethylfluorene.
| Compound Name | 2-[9,9-bis(3-methylbutyl)fluoren-2-yl]-7-[7-bromo-9,9-bis(3-methylbutyl)fluoren-2-yl]-9,9-diethylfluorene |
|---|---|
| PubChem CID | 59801302 |
| Molecular Formula | C63H73Br |
| Molecular Weight | 910.18 g/mol |
| Exact Mass | 908.49 |
| IUPAC Name | 2-[9,9-bis(3-methylbutyl)fluoren-2-yl]-7-[7-bromo-9,9-bis(3-methylbutyl)fluoren-2-yl]-9,9-diethylfluorene |
| SMILES | CCC1(CC)c2cc(-c3ccc4c(c3)C(CCC(C)C)(CCC(C)C)c3ccccc3-4)ccc2-c2ccc(-c3ccc4c(c3)C(CCC(C)C)(CCC(C)C)c3cc(Br)ccc3-4)cc21 |
| InChI | InChI=1S/C63H73Br/c1-11-61(12-2)56-35-44(46-17-22-50-49-15-13-14-16-55(49)62(58(50)37-46,31-27-40(3)4)32-28-41(5)6)18-23-51(56)52-24-19-45(36-57(52)61)47-20-25-53-54-26-21-48(64)39-60(54)63(59(53)38-47,33-29-42(7)8)34-30-43(9)10/h13-26,35-43H,11-12,27-34H2,1-10H3 |
| InChIKey | ANSPOMXRWZAIPS-UHFFFAOYSA-N |
| XLogP | 19.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.18 |
| LogP ≤ 5 | 19.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |