C107H124BBr — CID 89223321
CID 89223321 (PubChem CID 89223321) has the molecular formula C107H124BBr and a molecular weight of 1500.88 g/mol.
| Compound Name | CID 89223321 |
|---|---|
| PubChem CID | 89223321 |
| Molecular Formula | C107H124BBr |
| Molecular Weight | 1500.88 g/mol |
| Exact Mass | 1498.90 |
| IUPAC Name | — |
| SMILES | [B]c1cc(-c2ccc3c(c2)C(CCC(C)C)(CCC(C)C)c2cc(-c4ccc5c(c4)C(CCC(C)C)(CCC(C)C)c4ccccc4-5)ccc2-3)cc2c1-c1c(Br)cc(-c3ccc4c(c3)C(CCC(C)C)(CCC(C)C)c3cc(-c5ccc6c(c5)C(CCC(C)C)(CCC(C)C)c5ccccc5-6)ccc3-4)cc1C2(C)C |
| InChI | InChI=1S/C107H124BBr/c1-65(2)39-47-104(48-40-66(3)4)89-25-21-19-23-81(89)83-33-27-73(55-91(83)104)75-29-35-85-87-37-31-77(59-95(87)106(93(85)57-75,51-43-69(9)10)52-44-70(11)12)79-61-97-101(99(108)63-79)102-98(103(97,17)18)62-80(64-100(102)109)78-32-38-88-86-36-30-76(58-94(86)107(96(88)60-78,53-45-71(13)14)54-46-72(15)16)74-28-34-84-82-24-20-22-26-90(82)105(92(84)56-74,49-41-67(5)6)50-42-68(7)8/h19-38,55-72H,39-54H2,1-18H3 |
| InChIKey | XYSCTZGLMHSAHH-UHFFFAOYSA-N |
| XLogP | 30.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 28 |
| Heavy Atoms | 109 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1500.88 |
| LogP ≤ 5 | 30.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|