C95H87N — CID 89223325
9,9-dimethyl-N,N-diphenyl-7-[3,6,7-tris(9,9-dimethylfluoren-2-yl)-9,9-bis(3-methylbutyl)fluoren-2-yl]fluoren-2-amine (PubChem CID 89223325) has the molecular formula C95H87N and a molecular weight of 1242.75 g/mol. Its IUPAC name is 9,9-dimethyl-N,N-diphenyl-7-[3,6,7-tris(9,9-dimethylfluoren-2-yl)-9,9-bis(3-methylbutyl)fluoren-2-yl]fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N,N-diphenyl-7-[3,6,7-tris(9,9-dimethylfluoren-2-yl)-9,9-bis(3-methylbutyl)fluoren-2-yl]fluoren-2-amine |
|---|---|
| PubChem CID | 89223325 |
| Molecular Formula | C95H87N |
| Molecular Weight | 1242.75 g/mol |
| Exact Mass | 1241.68 |
| IUPAC Name | 9,9-dimethyl-N,N-diphenyl-7-[3,6,7-tris(9,9-dimethylfluoren-2-yl)-9,9-bis(3-methylbutyl)fluoren-2-yl]fluoren-2-amine |
| SMILES | CC(C)CCC1(CCC(C)C)c2cc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2-c2cc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c(-c3ccc4c(c3)C(C)(C)c3cc(N(c5ccccc5)c5ccccc5)ccc3-4)cc21 |
| InChI | InChI=1S/C95H87N/c1-58(2)45-47-95(48-46-59(3)4)89-56-77(62-37-42-72-69-31-21-24-34-83(69)93(9,10)86(72)51-62)75(60-35-40-70-67-29-19-22-32-81(67)91(5,6)84(70)49-60)54-79(89)80-55-76(61-36-41-71-68-30-20-23-33-82(68)92(7,8)85(71)50-61)78(57-90(80)95)63-38-43-73-74-44-39-66(53-88(74)94(11,12)87(73)52-63)96(64-25-15-13-16-26-64)65-27-17-14-18-28-65/h13-44,49-59H,45-48H2,1-12H3 |
| InChIKey | TYVKMCPSLVYMCK-UHFFFAOYSA-N |
| XLogP | 26.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 96 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1242.75 |
| LogP ≤ 5 | 26.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |