C63H59N — CID 177084420
N-[4-[3-(1,1,2,2,3,3-hexamethylinden-5-yl)-9,9-dimethylfluoren-2-yl]phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine (PubChem CID 177084420) has the molecular formula C63H59N and a molecular weight of 830.17 g/mol. Its IUPAC name is N-[4-[3-(1,1,2,2,3,3-hexamethylinden-5-yl)-9,9-dimethylfluoren-2-yl]phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | N-[4-[3-(1,1,2,2,3,3-hexamethylinden-5-yl)-9,9-dimethylfluoren-2-yl]phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 177084420 |
| Molecular Formula | C63H59N |
| Molecular Weight | 830.17 g/mol |
| Exact Mass | 829.46 |
| IUPAC Name | N-[4-[3-(1,1,2,2,3,3-hexamethylinden-5-yl)-9,9-dimethylfluoren-2-yl]phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4cc5c(cc4-c4ccc6c(c4)C(C)(C)C(C)(C)C6(C)C)-c4ccccc4C5(C)C)cc3)cc21 |
| InChI | InChI=1S/C63H59N/c1-59(2)53-22-16-14-20-47(53)49-34-33-46(37-56(49)59)64(44-29-24-41(25-30-44)40-18-12-11-13-19-40)45-31-26-42(27-32-45)51-39-57-52(48-21-15-17-23-54(48)60(57,3)4)38-50(51)43-28-35-55-58(36-43)62(7,8)63(9,10)61(55,5)6/h11-39H,1-10H3 |
| InChIKey | KFAHESRKOACOBC-UHFFFAOYSA-N |
| XLogP | 17.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.17 |
| LogP ≤ 5 | 17.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |