C54H51N — CID 177269838
N-[3-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)phenyl]-9,9-dimethyl-N-(3-phenylphenyl)fluoren-2-amine (PubChem CID 177269838) has the molecular formula C54H51N and a molecular weight of 714.01 g/mol. Its IUPAC name is N-[3-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)phenyl]-9,9-dimethyl-N-(3-phenylphenyl)fluoren-2-amine.
| Compound Name | N-[3-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)phenyl]-9,9-dimethyl-N-(3-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 177269838 |
| Molecular Formula | C54H51N |
| Molecular Weight | 714.01 g/mol |
| Exact Mass | 713.40 |
| IUPAC Name | N-[3-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)phenyl]-9,9-dimethyl-N-(3-phenylphenyl)fluoren-2-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3cccc(-c4ccccc4)c3)c3cccc(-c4cc5c(cc4-c4ccccc4)C(C)(C)C(C)(C)C5(C)C)c3)cc21 |
| InChI | InChI=1S/C54H51N/c1-51(2)47-28-16-15-27-43(47)44-30-29-42(33-48(44)51)55(40-25-17-23-38(31-40)36-19-11-9-12-20-36)41-26-18-24-39(32-41)46-35-50-49(34-45(46)37-21-13-10-14-22-37)52(3,4)54(7,8)53(50,5)6/h9-35H,1-8H3 |
| InChIKey | IFDRWMCUMAIMRH-UHFFFAOYSA-N |
| XLogP | 15.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.01 |
| LogP ≤ 5 | 15.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |