C48H46BrN — CID 177269868
N-[4-(6-bromo-1,1,2,2,3,3-hexamethylinden-5-yl)phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine (PubChem CID 177269868) has the molecular formula C48H46BrN and a molecular weight of 716.81 g/mol. Its IUPAC name is N-[4-(6-bromo-1,1,2,2,3,3-hexamethylinden-5-yl)phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | N-[4-(6-bromo-1,1,2,2,3,3-hexamethylinden-5-yl)phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 177269868 |
| Molecular Formula | C48H46BrN |
| Molecular Weight | 716.81 g/mol |
| Exact Mass | 715.28 |
| IUPAC Name | N-[4-(6-bromo-1,1,2,2,3,3-hexamethylinden-5-yl)phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4cc5c(cc4Br)C(C)(C)C(C)(C)C5(C)C)cc3)cc21 |
| InChI | InChI=1S/C48H46BrN/c1-45(2)40-17-13-12-16-37(40)38-27-26-36(28-41(38)45)50(34-22-18-32(19-23-34)31-14-10-9-11-15-31)35-24-20-33(21-25-35)39-29-42-43(30-44(39)49)47(5,6)48(7,8)46(42,3)4/h9-30H,1-8H3 |
| InChIKey | HPCWYKMLEFNTHA-UHFFFAOYSA-N |
| XLogP | 14.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.81 |
| LogP ≤ 5 | 14.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |